C23H23N4O2P — CID 3390781
N-bis(4-methylanilino)phosphoryl-1H-indole-3-carboxamide (PubChem CID 3390781) has the molecular formula C23H23N4O2P and a molecular weight of 418.44 g/mol. Its IUPAC name is N-bis(4-methylanilino)phosphoryl-1H-indole-3-carboxamide.
| Compound Name | N-bis(4-methylanilino)phosphoryl-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 3390781 |
| Molecular Formula | C23H23N4O2P |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N-bis(4-methylanilino)phosphoryl-1H-indole-3-carboxamide |
| SMILES | Cc1ccc(NP(=O)(NC(=O)c2c[nH]c3ccccc23)Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C23H23N4O2P/c1-16-7-11-18(12-8-16)25-30(29,26-19-13-9-17(2)10-14-19)27-23(28)21-15-24-22-6-4-3-5-20(21)22/h3-15,24H,1-2H3,(H3,25,26,27,28,29) |
| InChIKey | IGNPCRLJZCWXGB-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 86.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|