C15H8Cl2FNO — CID 3391107
5,7-dichloro-4-(4-fluorophenoxy)quinoline (PubChem CID 3391107) has the molecular formula C15H8Cl2FNO and a molecular weight of 308.14 g/mol. Its IUPAC name is 5,7-dichloro-4-(4-fluorophenoxy)quinoline.
| Compound Name | 5,7-dichloro-4-(4-fluorophenoxy)quinoline |
|---|---|
| PubChem CID | 3391107 |
| Molecular Formula | C15H8Cl2FNO |
| Molecular Weight | 308.14 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | 5,7-dichloro-4-(4-fluorophenoxy)quinoline |
| SMILES | Fc1ccc(Oc2ccnc3cc(Cl)cc(Cl)c23)cc1 |
| InChI | InChI=1S/C15H8Cl2FNO/c16-9-7-12(17)15-13(8-9)19-6-5-14(15)20-11-3-1-10(18)2-4-11/h1-8H |
| InChIKey | WRPIRSINYZBGPK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.14 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |