About 1,3-bis(but-2-enyl)-2,4-dihydroquinazoline
1,3-bis(but-2-enyl)-2,4-dihydroquinazoline (PubChem CID 3391327) has the molecular formula C16H22N2
and a molecular weight of 242.37 g/mol. Its IUPAC name is 1,3-bis(but-2-enyl)-2,4-dihydroquinazoline.
Molecular Properties
| Compound Name | 1,3-bis(but-2-enyl)-2,4-dihydroquinazoline |
| PubChem CID | 3391327 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 1,3-bis(but-2-enyl)-2,4-dihydroquinazoline |
| SMILES | CC=CCN1Cc2ccccc2N(CC=CC)C1 |
| InChI | InChI=1S/C16H22N2/c1-3-5-11-17-13-15-9-7-8-10-16(15)18(14-17)12-6-4-2/h3-10H,11-14H2,1-2H3 |
| InChIKey | IWLQQZIEANJEBJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1,3-bis(but-2-enyl)-2,4-dihydroquinazoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(but-2-enyl)-2,4-dihydroquinazoline?
The IUPAC name of 1,3-bis(but-2-enyl)-2,4-dihydroquinazoline (CID 3391327) is 1,3-bis(but-2-enyl)-2,4-dihydroquinazoline.
What is the SMILES notation for 1,3-bis(but-2-enyl)-2,4-dihydroquinazoline?
The canonical SMILES for 1,3-bis(but-2-enyl)-2,4-dihydroquinazoline is CC=CCN1Cc2ccccc2N(CC=CC)C1.
What is the InChIKey of 1,3-bis(but-2-enyl)-2,4-dihydroquinazoline?
The InChIKey is IWLQQZIEANJEBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2/c1-3-5-11-17-13-15-9-7-8-10-16(15)18(14-17)12-6-4-2/h3-10H,11-14H2,1-2H3.
What are the key properties of 1,3-bis(but-2-enyl)-2,4-dihydroquinazoline?
1,3-bis(but-2-enyl)-2,4-dihydroquinazoline has a molecular weight of 242.37 g/mol, XLogP of 3.42, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(but-2-enyl)-2,4-dihydroquinazoline is sourced from PubChem (CID 3391327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).