C15H12B3N3O3 — CID 3391847
4-(4,6-dipyridin-4-yl-1,3,5,2,4,6-trioxatriborinan-2-yl)pyridine (PubChem CID 3391847) has the molecular formula C15H12B3N3O3 and a molecular weight of 314.72 g/mol. Its IUPAC name is 4-(4,6-dipyridin-4-yl-1,3,5,2,4,6-trioxatriborinan-2-yl)pyridine.
| Compound Name | 4-(4,6-dipyridin-4-yl-1,3,5,2,4,6-trioxatriborinan-2-yl)pyridine |
|---|---|
| PubChem CID | 3391847 |
| Molecular Formula | C15H12B3N3O3 |
| Molecular Weight | 314.72 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 4-(4,6-dipyridin-4-yl-1,3,5,2,4,6-trioxatriborinan-2-yl)pyridine |
| SMILES | c1cc(B2OB(c3ccncc3)OB(c3ccncc3)O2)ccn1 |
| InChI | InChI=1S/C15H12B3N3O3/c1-7-19-8-2-13(1)16-22-17(14-3-9-20-10-4-14)24-18(23-16)15-5-11-21-12-6-15/h1-12H |
| InChIKey | UACYUASFRMWNBO-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.72 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|