C14H17NO2 — CID 3392603
8,8-dimethyl-6-methylidene-2,3,7,9-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline (PubChem CID 3392603) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is 8,8-dimethyl-6-methylidene-2,3,7,9-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline.
| Compound Name | 8,8-dimethyl-6-methylidene-2,3,7,9-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline |
|---|---|
| PubChem CID | 3392603 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 8,8-dimethyl-6-methylidene-2,3,7,9-tetrahydro-[1,4]dioxino[2,3-g]isoquinoline |
| SMILES | C=C1NC(C)(C)Cc2cc3c(cc21)OCCO3 |
| InChI | InChI=1S/C14H17NO2/c1-9-11-7-13-12(16-4-5-17-13)6-10(11)8-14(2,3)15-9/h6-7,15H,1,4-5,8H2,2-3H3 |
| InChIKey | GWXCUUBVRFUOPG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |