C16H18N2O4 — CID 3392735
1,8,8-trimethyl-3-(3-nitrophenyl)-3-azabicyclo[3.2.1]octane-2,4-dione (PubChem CID 3392735) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 1,8,8-trimethyl-3-(3-nitrophenyl)-3-azabicyclo[3.2.1]octane-2,4-dione.
| Compound Name | 1,8,8-trimethyl-3-(3-nitrophenyl)-3-azabicyclo[3.2.1]octane-2,4-dione |
|---|---|
| PubChem CID | 3392735 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 1,8,8-trimethyl-3-(3-nitrophenyl)-3-azabicyclo[3.2.1]octane-2,4-dione |
| SMILES | CC12CCC(C(=O)N(c3cccc([N+](=O)[O-])c3)C1=O)C2(C)C |
| InChI | InChI=1S/C16H18N2O4/c1-15(2)12-7-8-16(15,3)14(20)17(13(12)19)10-5-4-6-11(9-10)18(21)22/h4-6,9,12H,7-8H2,1-3H3 |
| InChIKey | YHWAXZOCGIWBAZ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|