About 2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)ethyl pentanoate
2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)ethyl pentanoate (PubChem CID 3392794) has the molecular formula C24H28N2O4
and a molecular weight of 408.50 g/mol. Its IUPAC name is 2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)ethyl pentanoate.
Molecular Properties
| Compound Name | 2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)ethyl pentanoate |
| PubChem CID | 3392794 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)ethyl pentanoate |
| SMILES | CCCCC(=O)OCCN1C(=O)c2cccc3c(N4CCCCC4)ccc(c23)C1=O |
| InChI | InChI=1S/C24H28N2O4/c1-2-3-10-21(27)30-16-15-26-23(28)18-9-7-8-17-20(25-13-5-4-6-14-25)12-11-19(22(17)18)24(26)29/h7-9,11-12H,2-6,10,13-16H2,1H3 |
| InChIKey | UJVZIZSSXKBQKH-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)ethyl pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)ethyl pentanoate?
The IUPAC name of 2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)ethyl pentanoate (CID 3392794) is 2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)ethyl pentanoate.
What is the SMILES notation for 2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)ethyl pentanoate?
The canonical SMILES for 2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)ethyl pentanoate is CCCCC(=O)OCCN1C(=O)c2cccc3c(N4CCCCC4)ccc(c23)C1=O.
What is the InChIKey of 2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)ethyl pentanoate?
The InChIKey is UJVZIZSSXKBQKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N2O4/c1-2-3-10-21(27)30-16-15-26-23(28)18-9-7-8-17-20(25-13-5-4-6-14-25)12-11-19(22(17)18)24(26)29/h7-9,11-12H,2-6,10,13-16H2,1H3.
What are the key properties of 2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)ethyl pentanoate?
2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)ethyl pentanoate has a molecular weight of 408.50 g/mol, XLogP of 4.16, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dioxo-6-piperidin-1-ylbenzo[de]isoquinolin-2-yl)ethyl pentanoate is sourced from PubChem (CID 3392794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).