C21H23N5O2 — CID 3393026
3-[4-(diethylamino)phenyl]-6-imino-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 3393026) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is 3-[4-(diethylamino)phenyl]-6-imino-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 3-[4-(diethylamino)phenyl]-6-imino-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 3393026 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 3-[4-(diethylamino)phenyl]-6-imino-1,8-dimethyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(C)OC(c3ccc(N(CC)CC)cc3)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C21H23N5O2/c1-5-26(6-2)16-9-7-15(8-10-16)17-20(11-22,12-23)21(13-24)14(3)19(4,27-17)28-18(21)25/h7-10,14,17,25H,5-6H2,1-4H3/b25-18- |
| InChIKey | GVUUUINMDUBABJ-BWAHOGKJSA-N |
| XLogP | 3.51 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|