C33H31BrN2O2 — CID 3393057
2-bromo-4-[(4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)iminomethyl]-6-ethoxyphenol (PubChem CID 3393057) has the molecular formula C33H31BrN2O2 and a molecular weight of 567.53 g/mol. Its IUPAC name is 2-bromo-4-[(4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)iminomethyl]-6-ethoxyphenol.
| Compound Name | 2-bromo-4-[(4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)iminomethyl]-6-ethoxyphenol |
|---|---|
| PubChem CID | 3393057 |
| Molecular Formula | C33H31BrN2O2 |
| Molecular Weight | 567.53 g/mol |
| Exact Mass | 566.16 |
| IUPAC Name | 2-bromo-4-[(4,10-diphenyl-1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)iminomethyl]-6-ethoxyphenol |
| SMILES | CCOc1cc(/C=N/c2cc3c4c(c2)C(c2ccccc2)CCN4CCC3c2ccccc2)cc(Br)c1O |
| InChI | InChI=1S/C33H31BrN2O2/c1-2-38-31-18-22(17-30(34)33(31)37)21-35-25-19-28-26(23-9-5-3-6-10-23)13-15-36-16-14-27(29(20-25)32(28)36)24-11-7-4-8-12-24/h3-12,17-21,26-27,37H,2,13-16H2,1H3/b35-21+ |
| InChIKey | SYRMJTYLDCMPAS-XICOUIIWSA-N |
| XLogP | 8.18 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.53 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|