About 5-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-oxazolidine
5-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-oxazolidine (PubChem CID 3394089) has the molecular formula C12H16ClNO3
and a molecular weight of 257.72 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-oxazolidine.
Molecular Properties
| Compound Name | 5-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-oxazolidine |
| PubChem CID | 3394089 |
| Molecular Formula | C12H16ClNO3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | 5-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-oxazolidine |
| SMILES | COc1ccc(C2NCC(CCl)O2)c(OC)c1 |
| InChI | InChI=1S/C12H16ClNO3/c1-15-8-3-4-10(11(5-8)16-2)12-14-7-9(6-13)17-12/h3-5,9,12,14H,6-7H2,1-2H3 |
| InChIKey | CQHZVDXJJIDZJS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-oxazolidine?
The IUPAC name of 5-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-oxazolidine (CID 3394089) is 5-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-oxazolidine.
What is the SMILES notation for 5-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-oxazolidine?
The canonical SMILES for 5-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-oxazolidine is COc1ccc(C2NCC(CCl)O2)c(OC)c1.
What is the InChIKey of 5-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-oxazolidine?
The InChIKey is CQHZVDXJJIDZJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16ClNO3/c1-15-8-3-4-10(11(5-8)16-2)12-14-7-9(6-13)17-12/h3-5,9,12,14H,6-7H2,1-2H3.
What are the key properties of 5-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-oxazolidine?
5-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-oxazolidine has a molecular weight of 257.72 g/mol, XLogP of 1.93, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)-2-(2,4-dimethoxyphenyl)-1,3-oxazolidine is sourced from PubChem (CID 3394089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).