C18H11Br2N3 — CID 3394234
2-amino-4,6-bis(4-bromophenyl)pyridine-3-carbonitrile (PubChem CID 3394234) has the molecular formula C18H11Br2N3 and a molecular weight of 429.12 g/mol. Its IUPAC name is 2-amino-4,6-bis(4-bromophenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-4,6-bis(4-bromophenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3394234 |
| Molecular Formula | C18H11Br2N3 |
| Molecular Weight | 429.12 g/mol |
| Exact Mass | 426.93 |
| IUPAC Name | 2-amino-4,6-bis(4-bromophenyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(Br)cc2)cc(-c2ccc(Br)cc2)nc1N |
| InChI | InChI=1S/C18H11Br2N3/c19-13-5-1-11(2-6-13)15-9-17(23-18(22)16(15)10-21)12-3-7-14(20)8-4-12/h1-9H,(H2,22,23) |
| InChIKey | YKUXYXWBUCHOJP-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.12 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |