About 1,5-dihydro-2,4-benzodioxepin-3-ylmethyl(furan-2-ylmethyl)azanium
1,5-dihydro-2,4-benzodioxepin-3-ylmethyl(furan-2-ylmethyl)azanium (PubChem CID 3394360) has the molecular formula C15H18NO3+
and a molecular weight of 260.31 g/mol. Its IUPAC name is 1,5-dihydro-2,4-benzodioxepin-3-ylmethyl(furan-2-ylmethyl)azanium.
Molecular Properties
| Compound Name | 1,5-dihydro-2,4-benzodioxepin-3-ylmethyl(furan-2-ylmethyl)azanium |
| PubChem CID | 3394360 |
| Molecular Formula | C15H18NO3+ |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 1,5-dihydro-2,4-benzodioxepin-3-ylmethyl(furan-2-ylmethyl)azanium |
| SMILES | c1coc(C[NH2+]CC2OCc3ccccc3CO2)c1 |
| InChI | InChI=1S/C15H17NO3/c1-2-5-13-11-19-15(18-10-12(13)4-1)9-16-8-14-6-3-7-17-14/h1-7,15-16H,8-11H2/p+1 |
| InChIKey | BFWYUNAKVHMCCE-UHFFFAOYSA-O |
| XLogP | 1.42 |
| TPSA | 48.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,5-dihydro-2,4-benzodioxepin-3-ylmethyl(furan-2-ylmethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dihydro-2,4-benzodioxepin-3-ylmethyl(furan-2-ylmethyl)azanium?
The IUPAC name of 1,5-dihydro-2,4-benzodioxepin-3-ylmethyl(furan-2-ylmethyl)azanium (CID 3394360) is 1,5-dihydro-2,4-benzodioxepin-3-ylmethyl(furan-2-ylmethyl)azanium.
What is the SMILES notation for 1,5-dihydro-2,4-benzodioxepin-3-ylmethyl(furan-2-ylmethyl)azanium?
The canonical SMILES for 1,5-dihydro-2,4-benzodioxepin-3-ylmethyl(furan-2-ylmethyl)azanium is c1coc(C[NH2+]CC2OCc3ccccc3CO2)c1.
What is the InChIKey of 1,5-dihydro-2,4-benzodioxepin-3-ylmethyl(furan-2-ylmethyl)azanium?
The InChIKey is BFWYUNAKVHMCCE-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H17NO3/c1-2-5-13-11-19-15(18-10-12(13)4-1)9-16-8-14-6-3-7-17-14/h1-7,15-16H,8-11H2/p+1.
What are the key properties of 1,5-dihydro-2,4-benzodioxepin-3-ylmethyl(furan-2-ylmethyl)azanium?
1,5-dihydro-2,4-benzodioxepin-3-ylmethyl(furan-2-ylmethyl)azanium has a molecular weight of 260.31 g/mol, XLogP of 1.42, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dihydro-2,4-benzodioxepin-3-ylmethyl(furan-2-ylmethyl)azanium is sourced from PubChem (CID 3394360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).