C19H13Cl3N2O2S — CID 3394643
2-naphthalen-1-yloxy-N-[(2,4,5-trichlorophenyl)carbamothioyl]acetamide (PubChem CID 3394643) has the molecular formula C19H13Cl3N2O2S and a molecular weight of 439.75 g/mol. Its IUPAC name is 2-naphthalen-1-yloxy-N-[(2,4,5-trichlorophenyl)carbamothioyl]acetamide.
| Compound Name | 2-naphthalen-1-yloxy-N-[(2,4,5-trichlorophenyl)carbamothioyl]acetamide |
|---|---|
| PubChem CID | 3394643 |
| Molecular Formula | C19H13Cl3N2O2S |
| Molecular Weight | 439.75 g/mol |
| Exact Mass | 437.98 |
| IUPAC Name | 2-naphthalen-1-yloxy-N-[(2,4,5-trichlorophenyl)carbamothioyl]acetamide |
| SMILES | O=C(COc1cccc2ccccc12)NC(=S)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C19H13Cl3N2O2S/c20-13-8-15(22)16(9-14(13)21)23-19(27)24-18(25)10-26-17-7-3-5-11-4-1-2-6-12(11)17/h1-9H,10H2,(H2,23,24,25,27) |
| InChIKey | MEKGCUBIYJJAAU-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.75 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|