C5H8N6S2 — CID 3394692
[(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]carbamodithioic acid (PubChem CID 3394692) has the molecular formula C5H8N6S2 and a molecular weight of 216.29 g/mol. Its IUPAC name is [(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]carbamodithioic acid.
| Compound Name | [(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]carbamodithioic acid |
|---|---|
| PubChem CID | 3394692 |
| Molecular Formula | C5H8N6S2 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | [(4-amino-6-methyl-1,3,5-triazin-2-yl)amino]carbamodithioic acid |
| SMILES | Cc1nc(N)nc(NNC(=S)S)n1 |
| InChI | InChI=1S/C5H8N6S2/c1-2-7-3(6)9-4(8-2)10-11-5(12)13/h1H3,(H2,11,12,13)(H3,6,7,8,9,10) |
| InChIKey | GWQUCKDGGMZVKA-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 88.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|