C13H16N4O3S — CID 3394813
1-[(3-methyl-2-nitrobenzoyl)amino]-3-(2-methylprop-2-enyl)thiourea (PubChem CID 3394813) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 1-[(3-methyl-2-nitrobenzoyl)amino]-3-(2-methylprop-2-enyl)thiourea.
| Compound Name | 1-[(3-methyl-2-nitrobenzoyl)amino]-3-(2-methylprop-2-enyl)thiourea |
|---|---|
| PubChem CID | 3394813 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 1-[(3-methyl-2-nitrobenzoyl)amino]-3-(2-methylprop-2-enyl)thiourea |
| SMILES | C=C(C)CNC(=S)NNC(=O)c1cccc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H16N4O3S/c1-8(2)7-14-13(21)16-15-12(18)10-6-4-5-9(3)11(10)17(19)20/h4-6H,1,7H2,2-3H3,(H,15,18)(H2,14,16,21) |
| InChIKey | AROLQXGFGSUAQA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|