C27H21ClN2O5S — CID 3395646
[4-[[[4-[(4-chlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenyl] benzenesulfonate (PubChem CID 3395646) has the molecular formula C27H21ClN2O5S and a molecular weight of 520.99 g/mol. Its IUPAC name is [4-[[[4-[(4-chlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenyl] benzenesulfonate.
| Compound Name | [4-[[[4-[(4-chlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 3395646 |
| Molecular Formula | C27H21ClN2O5S |
| Molecular Weight | 520.99 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | [4-[[[4-[(4-chlorophenyl)methoxy]benzoyl]hydrazinylidene]methyl]phenyl] benzenesulfonate |
| SMILES | O=C(NN=Cc1ccc(OS(=O)(=O)c2ccccc2)cc1)c1ccc(OCc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C27H21ClN2O5S/c28-23-12-6-21(7-13-23)19-34-24-16-10-22(11-17-24)27(31)30-29-18-20-8-14-25(15-9-20)35-36(32,33)26-4-2-1-3-5-26/h1-18H,19H2,(H,30,31) |
| InChIKey | POIQVUWADPGFBV-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.99 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|