C20H16Cl2N4O3 — CID 3396011
7-[(2,6-dichlorophenyl)methyl]-1,3-dimethyl-8-phenoxypurine-2,6-dione (PubChem CID 3396011) has the molecular formula C20H16Cl2N4O3 and a molecular weight of 431.28 g/mol. Its IUPAC name is 7-[(2,6-dichlorophenyl)methyl]-1,3-dimethyl-8-phenoxypurine-2,6-dione.
| Compound Name | 7-[(2,6-dichlorophenyl)methyl]-1,3-dimethyl-8-phenoxypurine-2,6-dione |
|---|---|
| PubChem CID | 3396011 |
| Molecular Formula | C20H16Cl2N4O3 |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 7-[(2,6-dichlorophenyl)methyl]-1,3-dimethyl-8-phenoxypurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(Oc3ccccc3)n2Cc2c(Cl)cccc2Cl)n(C)c1=O |
| InChI | InChI=1S/C20H16Cl2N4O3/c1-24-17-16(18(27)25(2)20(24)28)26(11-13-14(21)9-6-10-15(13)22)19(23-17)29-12-7-4-3-5-8-12/h3-10H,11H2,1-2H3 |
| InChIKey | QZVSAQKNYPGFGC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 71.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |