C19H18N2O2 — CID 3396092
2-[[5-(ethoxymethylidene)-2,6,7,8-tetrahydro-1H-cyclopenta[b]chromen-3-yl]methylidene]propanedinitrile (PubChem CID 3396092) has the molecular formula C19H18N2O2 and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-[[5-(ethoxymethylidene)-2,6,7,8-tetrahydro-1H-cyclopenta[b]chromen-3-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[5-(ethoxymethylidene)-2,6,7,8-tetrahydro-1H-cyclopenta[b]chromen-3-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 3396092 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-[[5-(ethoxymethylidene)-2,6,7,8-tetrahydro-1H-cyclopenta[b]chromen-3-yl]methylidene]propanedinitrile |
| SMILES | CCOC=C1CCCC2=C1OC1=C(C=C(C#N)C#N)CCC1=C2 |
| InChI | InChI=1S/C19H18N2O2/c1-2-22-12-17-5-3-4-14-9-16-7-6-15(8-13(10-20)11-21)18(16)23-19(14)17/h8-9,12H,2-7H2,1H3 |
| InChIKey | HVACZJGIASBLQW-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|