C12H4Br2O4 — CID 3396119
2-bromo-5-(4-bromo-3,6-dioxocyclohexa-1,4-dien-1-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 3396119) has the molecular formula C12H4Br2O4 and a molecular weight of 371.97 g/mol. Its IUPAC name is 2-bromo-5-(4-bromo-3,6-dioxocyclohexa-1,4-dien-1-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-bromo-5-(4-bromo-3,6-dioxocyclohexa-1,4-dien-1-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 3396119 |
| Molecular Formula | C12H4Br2O4 |
| Molecular Weight | 371.97 g/mol |
| Exact Mass | 369.85 |
| IUPAC Name | 2-bromo-5-(4-bromo-3,6-dioxocyclohexa-1,4-dien-1-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | O=C1C=C(C2=CC(=O)C(Br)=CC2=O)C(=O)C=C1Br |
| InChI | InChI=1S/C12H4Br2O4/c13-7-3-9(15)5(1-11(7)17)6-2-12(18)8(14)4-10(6)16/h1-4H |
| InChIKey | SXFUISBAPABZJC-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.97 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|