C35H55NO5 — CID 3396148
cyclohexyl-[5-[[2,3-dihydroxypropyl(propyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone (PubChem CID 3396148) has the molecular formula C35H55NO5 and a molecular weight of 569.83 g/mol. Its IUPAC name is cyclohexyl-[5-[[2,3-dihydroxypropyl(propyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone.
| Compound Name | cyclohexyl-[5-[[2,3-dihydroxypropyl(propyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
|---|---|
| PubChem CID | 3396148 |
| Molecular Formula | C35H55NO5 |
| Molecular Weight | 569.83 g/mol |
| Exact Mass | 569.41 |
| IUPAC Name | cyclohexyl-[5-[[2,3-dihydroxypropyl(propyl)amino]methyl]-5,13-dihydroxy-6,10-dimethyl-17-pentacyclo[13.2.2.01,9.02,6.010,15]nonadeca-16,18-dienyl]methanone |
| SMILES | CCCN(CC(O)CO)CC1(O)CCC2C34C=CC5(C=C3C(=O)C3CCCCC3)CC(O)CCC5(C)C4CCC21C |
| InChI | InChI=1S/C35H55NO5/c1-4-18-36(21-26(39)22-37)23-34(41)15-12-29-32(34,3)14-11-28-31(2)13-10-25(38)19-33(31)16-17-35(28,29)27(20-33)30(40)24-8-6-5-7-9-24/h16-17,20,24-26,28-29,37-39,41H,4-15,18-19,21-23H2,1-3H3 |
| InChIKey | LKQFQBPROXTFDO-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.83 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|