C21H23N5 — CID 3396363
N,N-diethyl-4-(5-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)aniline (PubChem CID 3396363) has the molecular formula C21H23N5 and a molecular weight of 345.45 g/mol. Its IUPAC name is N,N-diethyl-4-(5-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)aniline.
| Compound Name | N,N-diethyl-4-(5-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)aniline |
|---|---|
| PubChem CID | 3396363 |
| Molecular Formula | C21H23N5 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.20 |
| IUPAC Name | N,N-diethyl-4-(5-phenyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)aniline |
| SMILES | CCN(CC)c1ccc(C2C=C(c3ccccc3)Nc3ncnn32)cc1 |
| InChI | InChI=1S/C21H23N5/c1-3-25(4-2)18-12-10-17(11-13-18)20-14-19(16-8-6-5-7-9-16)24-21-22-15-23-26(20)21/h5-15,20H,3-4H2,1-2H3,(H,22,23,24) |
| InChIKey | NFQSMPTYVQSMHU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|