C24H15Cl8N3O4S2 — CID 3396569
N-[1-anilino-2,3,5,5,6,6-hexachloro-4-(4-chlorophenyl)sulfonyliminocyclohex-2-en-1-yl]-4-chlorobenzenesulfonamide (PubChem CID 3396569) has the molecular formula C24H15Cl8N3O4S2 and a molecular weight of 757.16 g/mol. Its IUPAC name is N-[1-anilino-2,3,5,5,6,6-hexachloro-4-(4-chlorophenyl)sulfonyliminocyclohex-2-en-1-yl]-4-chlorobenzenesulfonamide.
| Compound Name | N-[1-anilino-2,3,5,5,6,6-hexachloro-4-(4-chlorophenyl)sulfonyliminocyclohex-2-en-1-yl]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 3396569 |
| Molecular Formula | C24H15Cl8N3O4S2 |
| Molecular Weight | 757.16 g/mol |
| Exact Mass | 752.80 |
| IUPAC Name | N-[1-anilino-2,3,5,5,6,6-hexachloro-4-(4-chlorophenyl)sulfonyliminocyclohex-2-en-1-yl]-4-chlorobenzenesulfonamide |
| SMILES | O=S(=O)(N=C1C(Cl)=C(Cl)C(Nc2ccccc2)(NS(=O)(=O)c2ccc(Cl)cc2)C(Cl)(Cl)C1(Cl)Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H15Cl8N3O4S2/c25-14-6-10-17(11-7-14)40(36,37)34-21-19(27)20(28)23(24(31,32)22(21,29)30,33-16-4-2-1-3-5-16)35-41(38,39)18-12-8-15(26)9-13-18/h1-13,33,35H |
| InChIKey | WBGLDCWUDVTVIS-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.16 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|