C17H15Cl5N2O4S — CID 3396572
4-methyl-N-(2,5,5,6,6-pentachloro-3-morpholin-4-yl-4-oxocyclohex-2-en-1-ylidene)benzenesulfonamide (PubChem CID 3396572) has the molecular formula C17H15Cl5N2O4S and a molecular weight of 520.65 g/mol. Its IUPAC name is 4-methyl-N-(2,5,5,6,6-pentachloro-3-morpholin-4-yl-4-oxocyclohex-2-en-1-ylidene)benzenesulfonamide.
| Compound Name | 4-methyl-N-(2,5,5,6,6-pentachloro-3-morpholin-4-yl-4-oxocyclohex-2-en-1-ylidene)benzenesulfonamide |
|---|---|
| PubChem CID | 3396572 |
| Molecular Formula | C17H15Cl5N2O4S |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 517.92 |
| IUPAC Name | 4-methyl-N-(2,5,5,6,6-pentachloro-3-morpholin-4-yl-4-oxocyclohex-2-en-1-ylidene)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N=C2C(Cl)=C(N3CCOCC3)C(=O)C(Cl)(Cl)C2(Cl)Cl)cc1 |
| InChI | InChI=1S/C17H15Cl5N2O4S/c1-10-2-4-11(5-3-10)29(26,27)23-14-12(18)13(24-6-8-28-9-7-24)15(25)17(21,22)16(14,19)20/h2-5H,6-9H2,1H3 |
| InChIKey | JNEWJHUTWQHKAH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|