About N-(Diphenylmethyl)-N-methyl-N'-[2-(4-morpholinyl)ethyl]thiourea
N-(Diphenylmethyl)-N-methyl-N'-[2-(4-morpholinyl)ethyl]thiourea (PubChem CID 3396611) has the molecular formula C21H27N3OS
and a molecular weight of 369.50 g/mol. Its IUPAC name is 1-benzhydryl-1-methyl-3-(2-morpholin-4-ylethyl)thiourea.
Molecular Properties
| Compound Name | N-(Diphenylmethyl)-N-methyl-N'-[2-(4-morpholinyl)ethyl]thiourea |
| PubChem CID | 3396611 |
| Molecular Formula | C21H27N3OS |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 1-benzhydryl-1-methyl-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | CN(C(C1=CC=CC=C1)C2=CC=CC=C2)C(=S)NCCN3CCOCC3 |
| InChI | InChI=1S/C21H27N3OS/c1-23(21(26)22-12-13-24-14-16-25-17-15-24)20(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,20H,12-17H2,1H3,(H,22,26) |
| InChIKey | MOCJBDPJFQWJBQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 59.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | 397 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(Diphenylmethyl)-N-methyl-N'-[2-(4-morpholinyl)ethyl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(Diphenylmethyl)-N-methyl-N'-[2-(4-morpholinyl)ethyl]thiourea?
The IUPAC name of N-(Diphenylmethyl)-N-methyl-N'-[2-(4-morpholinyl)ethyl]thiourea (CID 3396611) is 1-benzhydryl-1-methyl-3-(2-morpholin-4-ylethyl)thiourea.
What is the SMILES notation for N-(Diphenylmethyl)-N-methyl-N'-[2-(4-morpholinyl)ethyl]thiourea?
The canonical SMILES for N-(Diphenylmethyl)-N-methyl-N'-[2-(4-morpholinyl)ethyl]thiourea is CN(C(C1=CC=CC=C1)C2=CC=CC=C2)C(=S)NCCN3CCOCC3.
What is the InChIKey of N-(Diphenylmethyl)-N-methyl-N'-[2-(4-morpholinyl)ethyl]thiourea?
The InChIKey is MOCJBDPJFQWJBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27N3OS/c1-23(21(26)22-12-13-24-14-16-25-17-15-24)20(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,20H,12-17H2,1H3,(H,22,26).
What are the key properties of N-(Diphenylmethyl)-N-methyl-N'-[2-(4-morpholinyl)ethyl]thiourea?
N-(Diphenylmethyl)-N-methyl-N'-[2-(4-morpholinyl)ethyl]thiourea has a molecular weight of 369.50 g/mol, XLogP of 3.00, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(Diphenylmethyl)-N-methyl-N'-[2-(4-morpholinyl)ethyl]thiourea is sourced from PubChem (CID 3396611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).