C17H22O2 — CID 3396940
2,3-dimethyl-4-(2-methylprop-1-enyl)-3,3a,4,9b-tetrahydro-2H-furo[3,2-c]chromene (PubChem CID 3396940) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 2,3-dimethyl-4-(2-methylprop-1-enyl)-3,3a,4,9b-tetrahydro-2H-furo[3,2-c]chromene.
| Compound Name | 2,3-dimethyl-4-(2-methylprop-1-enyl)-3,3a,4,9b-tetrahydro-2H-furo[3,2-c]chromene |
|---|---|
| PubChem CID | 3396940 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 2,3-dimethyl-4-(2-methylprop-1-enyl)-3,3a,4,9b-tetrahydro-2H-furo[3,2-c]chromene |
| SMILES | CC(C)=CC1Oc2ccccc2C2OC(C)C(C)C12 |
| InChI | InChI=1S/C17H22O2/c1-10(2)9-15-16-11(3)12(4)18-17(16)13-7-5-6-8-14(13)19-15/h5-9,11-12,15-17H,1-4H3 |
| InChIKey | AMUXLNCGHIVWHK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|