C17H12BrF3N2O3 — CID 3397277
4-[2-(2-bromo-5-methoxy-4-prop-2-ynoxyphenyl)ethenyl]-6-(trifluoromethyl)-1H-pyrimidin-2-one (PubChem CID 3397277) has the molecular formula C17H12BrF3N2O3 and a molecular weight of 429.19 g/mol. Its IUPAC name is 4-[2-(2-bromo-5-methoxy-4-prop-2-ynoxyphenyl)ethenyl]-6-(trifluoromethyl)-1H-pyrimidin-2-one.
| Compound Name | 4-[2-(2-bromo-5-methoxy-4-prop-2-ynoxyphenyl)ethenyl]-6-(trifluoromethyl)-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 3397277 |
| Molecular Formula | C17H12BrF3N2O3 |
| Molecular Weight | 429.19 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | 4-[2-(2-bromo-5-methoxy-4-prop-2-ynoxyphenyl)ethenyl]-6-(trifluoromethyl)-1H-pyrimidin-2-one |
| SMILES | C#CCOc1cc(Br)c(C=Cc2cc(C(F)(F)F)[nH]c(=O)n2)cc1OC |
| InChI | InChI=1S/C17H12BrF3N2O3/c1-3-6-26-14-9-12(18)10(7-13(14)25-2)4-5-11-8-15(17(19,20)21)23-16(24)22-11/h1,4-5,7-9H,6H2,2H3,(H,22,23,24) |
| InChIKey | WJTQMGJLANCMNF-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.19 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|