C20H21N5O2 — CID 3397632
3-[4-(dimethylamino)phenyl]-1-ethyl-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile (PubChem CID 3397632) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-1-ethyl-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile.
| Compound Name | 3-[4-(dimethylamino)phenyl]-1-ethyl-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
|---|---|
| PubChem CID | 3397632 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-1-ethyl-6-imino-8-methyl-2,7-dioxabicyclo[3.2.1]octane-4,4,5-tricarbonitrile |
| SMILES | [H]/N=C1\OC2(CC)OC(c3ccc(N(C)C)cc3)C(C#N)(C#N)C1(C#N)C2C |
| InChI | InChI=1S/C20H21N5O2/c1-5-20-13(2)19(12-23,17(24)27-20)18(10-21,11-22)16(26-20)14-6-8-15(9-7-14)25(3)4/h6-9,13,16,24H,5H2,1-4H3/b24-17- |
| InChIKey | ZRQHFBLRWRNIKP-ULJHMMPZSA-N |
| XLogP | 3.12 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|