C26H25N3O5S2 — CID 3397664
2-methylpropyl 7-methyl-5-(4-methylsulfanylphenyl)-2-[(4-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate (PubChem CID 3397664) has the molecular formula C26H25N3O5S2 and a molecular weight of 523.64 g/mol. Its IUPAC name is 2-methylpropyl 7-methyl-5-(4-methylsulfanylphenyl)-2-[(4-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate.
| Compound Name | 2-methylpropyl 7-methyl-5-(4-methylsulfanylphenyl)-2-[(4-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 3397664 |
| Molecular Formula | C26H25N3O5S2 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.12 |
| IUPAC Name | 2-methylpropyl 7-methyl-5-(4-methylsulfanylphenyl)-2-[(4-nitrophenyl)methylidene]-3-oxo-5H-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxylate |
| SMILES | CSc1ccc(C2C(C(=O)OCC(C)C)=C(C)N=c3sc(=Cc4ccc([N+](=O)[O-])cc4)c(=O)n32)cc1 |
| InChI | InChI=1S/C26H25N3O5S2/c1-15(2)14-34-25(31)22-16(3)27-26-28(23(22)18-7-11-20(35-4)12-8-18)24(30)21(36-26)13-17-5-9-19(10-6-17)29(32)33/h5-13,15,23H,14H2,1-4H3 |
| InChIKey | MWPFSYRSWMQKDZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 103.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|