C22H23F3N2O5S — CID 3397844
[2-(2-methyl-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 2-(trifluoromethyl)benzoate (PubChem CID 3397844) has the molecular formula C22H23F3N2O5S and a molecular weight of 484.50 g/mol. Its IUPAC name is [2-(2-methyl-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 2-(trifluoromethyl)benzoate.
| Compound Name | [2-(2-methyl-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 3397844 |
| Molecular Formula | C22H23F3N2O5S |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | [2-(2-methyl-5-piperidin-1-ylsulfonylanilino)-2-oxoethyl] 2-(trifluoromethyl)benzoate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCCC2)cc1NC(=O)COC(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C22H23F3N2O5S/c1-15-9-10-16(33(30,31)27-11-5-2-6-12-27)13-19(15)26-20(28)14-32-21(29)17-7-3-4-8-18(17)22(23,24)25/h3-4,7-10,13H,2,5-6,11-12,14H2,1H3,(H,26,28) |
| InChIKey | UQVSGKHRKJGPIG-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |