C20H23NO4 — CID 3397998
3-[[3-(4-ethoxyphenyl)-3-oxopropyl]azaniumyl]-3-phenylpropanoate (PubChem CID 3397998) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 3-[[3-(4-ethoxyphenyl)-3-oxopropyl]azaniumyl]-3-phenylpropanoate.
| Compound Name | 3-[[3-(4-ethoxyphenyl)-3-oxopropyl]azaniumyl]-3-phenylpropanoate |
|---|---|
| PubChem CID | 3397998 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 3-[[3-(4-ethoxyphenyl)-3-oxopropyl]azaniumyl]-3-phenylpropanoate |
| SMILES | CCOc1ccc(C(=O)CC[NH2+]C(CC(=O)[O-])c2ccccc2)cc1 |
| InChI | InChI=1S/C20H23NO4/c1-2-25-17-10-8-16(9-11-17)19(22)12-13-21-18(14-20(23)24)15-6-4-3-5-7-15/h3-11,18,21H,2,12-14H2,1H3,(H,23,24) |
| InChIKey | AFEQIBLYWDLARE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |