C15H17NS — CID 3398163
1,2,2a,8b-tetramethyl-4H-cyclobuta[c]quinoline-3-thione (PubChem CID 3398163) has the molecular formula C15H17NS and a molecular weight of 243.38 g/mol. Its IUPAC name is 1,2,2a,8b-tetramethyl-4H-cyclobuta[c]quinoline-3-thione.
| Compound Name | 1,2,2a,8b-tetramethyl-4H-cyclobuta[c]quinoline-3-thione |
|---|---|
| PubChem CID | 3398163 |
| Molecular Formula | C15H17NS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | 1,2,2a,8b-tetramethyl-4H-cyclobuta[c]quinoline-3-thione |
| SMILES | CC1=C(C)C2(C)c3ccccc3NC(=S)C12C |
| InChI | InChI=1S/C15H17NS/c1-9-10(2)15(4)13(17)16-12-8-6-5-7-11(12)14(9,15)3/h5-8H,1-4H3,(H,16,17) |
| InChIKey | IEZZRTGTJVRZEY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|