C24H31N3O2 — CID 3398277
N-butan-2-yl-N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3-phenylprop-2-enamide (PubChem CID 3398277) has the molecular formula C24H31N3O2 and a molecular weight of 393.53 g/mol. Its IUPAC name is N-butan-2-yl-N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3-phenylprop-2-enamide.
| Compound Name | N-butan-2-yl-N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 3398277 |
| Molecular Formula | C24H31N3O2 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | N-butan-2-yl-N-[2-[cyclopropyl-[(1-methylpyrrol-2-yl)methyl]amino]-2-oxoethyl]-3-phenylprop-2-enamide |
| SMILES | CCC(C)N(CC(=O)N(Cc1cccn1C)C1CC1)C(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C24H31N3O2/c1-4-19(2)26(23(28)15-12-20-9-6-5-7-10-20)18-24(29)27(21-13-14-21)17-22-11-8-16-25(22)3/h5-12,15-16,19,21H,4,13-14,17-18H2,1-3H3 |
| InChIKey | SLLJKXTYSZUQEQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|