C30H30N2O7S — CID 3400528
2-(4-butoxy-3-ethoxyphenyl)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-(furan-2-carbonyl)-4-hydroxy-2H-pyrrol-5-one (PubChem CID 3400528) has the molecular formula C30H30N2O7S and a molecular weight of 562.64 g/mol. Its IUPAC name is 2-(4-butoxy-3-ethoxyphenyl)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-(furan-2-carbonyl)-4-hydroxy-2H-pyrrol-5-one.
| Compound Name | 2-(4-butoxy-3-ethoxyphenyl)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-(furan-2-carbonyl)-4-hydroxy-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3400528 |
| Molecular Formula | C30H30N2O7S |
| Molecular Weight | 562.64 g/mol |
| Exact Mass | 562.18 |
| IUPAC Name | 2-(4-butoxy-3-ethoxyphenyl)-1-(6-ethoxy-1,3-benzothiazol-2-yl)-3-(furan-2-carbonyl)-4-hydroxy-2H-pyrrol-5-one |
| SMILES | CCCCOc1ccc(C2C(C(=O)c3ccco3)=C(O)C(=O)N2c2nc3ccc(OCC)cc3s2)cc1OCC |
| InChI | InChI=1S/C30H30N2O7S/c1-4-7-14-38-21-13-10-18(16-23(21)37-6-3)26-25(27(33)22-9-8-15-39-22)28(34)29(35)32(26)30-31-20-12-11-19(36-5-2)17-24(20)40-30/h8-13,15-17,26,34H,4-7,14H2,1-3H3 |
| InChIKey | SKOYGSCBEZZPGM-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 111.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.64 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|