About piperidine-3,4-diol
piperidine-3,4-diol (PubChem CID 3400854) has the molecular formula C5H11NO2
and a molecular weight of 117.15 g/mol. Its IUPAC name is piperidine-3,4-diol.
Molecular Properties
| Compound Name | piperidine-3,4-diol |
| PubChem CID | 3400854 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | piperidine-3,4-diol |
| SMILES | OC1CCNCC1O |
| InChI | InChI=1S/C5H11NO2/c7-4-1-2-6-3-5(4)8/h4-8H,1-3H2 |
| InChIKey | IZXWMVPZODQBRB-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze piperidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidine-3,4-diol?
The IUPAC name of piperidine-3,4-diol (CID 3400854) is piperidine-3,4-diol.
What is the SMILES notation for piperidine-3,4-diol?
The canonical SMILES for piperidine-3,4-diol is OC1CCNCC1O.
What is the InChIKey of piperidine-3,4-diol?
The InChIKey is IZXWMVPZODQBRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2/c7-4-1-2-6-3-5(4)8/h4-8H,1-3H2.
What are the key properties of piperidine-3,4-diol?
piperidine-3,4-diol has a molecular weight of 117.15 g/mol, XLogP of -1.30, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for piperidine-3,4-diol is sourced from PubChem (CID 3400854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).