About N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]tetrazolo[1,5-b]pyridazin-6-amine
N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]tetrazolo[1,5-b]pyridazin-6-amine (PubChem CID 34009199) has the molecular formula C17H21N7
and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]tetrazolo[1,5-b]pyridazin-6-amine.
Molecular Properties
| Compound Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]tetrazolo[1,5-b]pyridazin-6-amine |
| PubChem CID | 34009199 |
| Molecular Formula | C17H21N7 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]tetrazolo[1,5-b]pyridazin-6-amine |
| SMILES | CC(C)(CNc1ccc2nnnn2n1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C17H21N7/c1-17(2,23-10-9-13-5-3-4-6-14(13)11-23)12-18-15-7-8-16-19-21-22-24(16)20-15/h3-8H,9-12H2,1-2H3,(H,18,20) |
| InChIKey | GRMONQMIQSRLQL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]tetrazolo[1,5-b]pyridazin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]tetrazolo[1,5-b]pyridazin-6-amine?
The IUPAC name of N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]tetrazolo[1,5-b]pyridazin-6-amine (CID 34009199) is N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]tetrazolo[1,5-b]pyridazin-6-amine.
What is the SMILES notation for N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]tetrazolo[1,5-b]pyridazin-6-amine?
The canonical SMILES for N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]tetrazolo[1,5-b]pyridazin-6-amine is CC(C)(CNc1ccc2nnnn2n1)N1CCc2ccccc2C1.
What is the InChIKey of N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]tetrazolo[1,5-b]pyridazin-6-amine?
The InChIKey is GRMONQMIQSRLQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N7/c1-17(2,23-10-9-13-5-3-4-6-14(13)11-23)12-18-15-7-8-16-19-21-22-24(16)20-15/h3-8H,9-12H2,1-2H3,(H,18,20).
What are the key properties of N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]tetrazolo[1,5-b]pyridazin-6-amine?
N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]tetrazolo[1,5-b]pyridazin-6-amine has a molecular weight of 323.40 g/mol, XLogP of 1.77, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methylpropyl]tetrazolo[1,5-b]pyridazin-6-amine is sourced from PubChem (CID 34009199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).