About 1-cyclohexyl-3-(2,5-dimethylphenyl)-1-(1-pyridin-3-ylethyl)thiourea
1-cyclohexyl-3-(2,5-dimethylphenyl)-1-(1-pyridin-3-ylethyl)thiourea (PubChem CID 3400971) has the molecular formula C22H29N3S
and a molecular weight of 367.56 g/mol. Its IUPAC name is 1-cyclohexyl-3-(2,5-dimethylphenyl)-1-(1-pyridin-3-ylethyl)thiourea.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-(2,5-dimethylphenyl)-1-(1-pyridin-3-ylethyl)thiourea |
| PubChem CID | 3400971 |
| Molecular Formula | C22H29N3S |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 1-cyclohexyl-3-(2,5-dimethylphenyl)-1-(1-pyridin-3-ylethyl)thiourea |
| SMILES | Cc1ccc(C)c(NC(=S)N(C2CCCCC2)C(C)c2cccnc2)c1 |
| InChI | InChI=1S/C22H29N3S/c1-16-11-12-17(2)21(14-16)24-22(26)25(20-9-5-4-6-10-20)18(3)19-8-7-13-23-15-19/h7-8,11-15,18,20H,4-6,9-10H2,1-3H3,(H,24,26) |
| InChIKey | ZZLZKULQKQWXBT-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexyl-3-(2,5-dimethylphenyl)-1-(1-pyridin-3-ylethyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-(2,5-dimethylphenyl)-1-(1-pyridin-3-ylethyl)thiourea?
The IUPAC name of 1-cyclohexyl-3-(2,5-dimethylphenyl)-1-(1-pyridin-3-ylethyl)thiourea (CID 3400971) is 1-cyclohexyl-3-(2,5-dimethylphenyl)-1-(1-pyridin-3-ylethyl)thiourea.
What is the SMILES notation for 1-cyclohexyl-3-(2,5-dimethylphenyl)-1-(1-pyridin-3-ylethyl)thiourea?
The canonical SMILES for 1-cyclohexyl-3-(2,5-dimethylphenyl)-1-(1-pyridin-3-ylethyl)thiourea is Cc1ccc(C)c(NC(=S)N(C2CCCCC2)C(C)c2cccnc2)c1.
What is the InChIKey of 1-cyclohexyl-3-(2,5-dimethylphenyl)-1-(1-pyridin-3-ylethyl)thiourea?
The InChIKey is ZZLZKULQKQWXBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H29N3S/c1-16-11-12-17(2)21(14-16)24-22(26)25(20-9-5-4-6-10-20)18(3)19-8-7-13-23-15-19/h7-8,11-15,18,20H,4-6,9-10H2,1-3H3,(H,24,26).
What are the key properties of 1-cyclohexyl-3-(2,5-dimethylphenyl)-1-(1-pyridin-3-ylethyl)thiourea?
1-cyclohexyl-3-(2,5-dimethylphenyl)-1-(1-pyridin-3-ylethyl)thiourea has a molecular weight of 367.56 g/mol, XLogP of 5.79, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-(2,5-dimethylphenyl)-1-(1-pyridin-3-ylethyl)thiourea is sourced from PubChem (CID 3400971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).