C18H16Cl2NO6PS — CID 3401644
N-(2,3-dichloro-1-dimethoxyphosphoryl-4-oxonaphthalen-1-yl)benzenesulfonamide (PubChem CID 3401644) has the molecular formula C18H16Cl2NO6PS and a molecular weight of 476.27 g/mol. Its IUPAC name is N-(2,3-dichloro-1-dimethoxyphosphoryl-4-oxonaphthalen-1-yl)benzenesulfonamide.
| Compound Name | N-(2,3-dichloro-1-dimethoxyphosphoryl-4-oxonaphthalen-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 3401644 |
| Molecular Formula | C18H16Cl2NO6PS |
| Molecular Weight | 476.27 g/mol |
| Exact Mass | 474.98 |
| IUPAC Name | N-(2,3-dichloro-1-dimethoxyphosphoryl-4-oxonaphthalen-1-yl)benzenesulfonamide |
| SMILES | COP(=O)(OC)C1(NS(=O)(=O)c2ccccc2)C(Cl)=C(Cl)C(=O)c2ccccc21 |
| InChI | InChI=1S/C18H16Cl2NO6PS/c1-26-28(23,27-2)18(21-29(24,25)12-8-4-3-5-9-12)14-11-7-6-10-13(14)16(22)15(19)17(18)20/h3-11,21H,1-2H3 |
| InChIKey | UQDBHOWOCDIGLU-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.27 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|