C19H20Cl3N4P — CID 3401726
N,N-diethyl-2,2-diphenyl-6-(trichloromethyl)-1,3,5-triaza-2lambda5-phosphacyclohexa-2,4,6-trien-4-amine (PubChem CID 3401726) has the molecular formula C19H20Cl3N4P and a molecular weight of 441.73 g/mol. Its IUPAC name is N,N-diethyl-2,2-diphenyl-6-(trichloromethyl)-1,3,5-triaza-2lambda5-phosphacyclohexa-2,4,6-trien-4-amine.
| Compound Name | N,N-diethyl-2,2-diphenyl-6-(trichloromethyl)-1,3,5-triaza-2lambda5-phosphacyclohexa-2,4,6-trien-4-amine |
|---|---|
| PubChem CID | 3401726 |
| Molecular Formula | C19H20Cl3N4P |
| Molecular Weight | 441.73 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | N,N-diethyl-2,2-diphenyl-6-(trichloromethyl)-1,3,5-triaza-2lambda5-phosphacyclohexa-2,4,6-trien-4-amine |
| SMILES | CCN(CC)C1=NC(C(Cl)(Cl)Cl)=NP(c2ccccc2)(c2ccccc2)=N1 |
| InChI | InChI=1S/C19H20Cl3N4P/c1-3-26(4-2)18-23-17(19(20,21)22)24-27(25-18,15-11-7-5-8-12-15)16-13-9-6-10-14-16/h5-14H,3-4H2,1-2H3 |
| InChIKey | YTZVUPCQLVVVCK-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 40.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.73 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|