C14H18N2O — CID 3402453
3a,4,4,6-tetramethyl-1,3-dihydroimidazo[1,2-a]indol-2-one (PubChem CID 3402453) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is 3a,4,4,6-tetramethyl-1,3-dihydroimidazo[1,2-a]indol-2-one.
| Compound Name | 3a,4,4,6-tetramethyl-1,3-dihydroimidazo[1,2-a]indol-2-one |
|---|---|
| PubChem CID | 3402453 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | 3a,4,4,6-tetramethyl-1,3-dihydroimidazo[1,2-a]indol-2-one |
| SMILES | Cc1ccc2c(c1)C(C)(C)C1(C)NC(=O)CN21 |
| InChI | InChI=1S/C14H18N2O/c1-9-5-6-11-10(7-9)13(2,3)14(4)15-12(17)8-16(11)14/h5-7H,8H2,1-4H3,(H,15,17) |
| InChIKey | RRCUVEQOVCHJJL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |