C10H6F3N5O4S — CID 3403145
3-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanyl-4-methyl-1,2,4-triazole (PubChem CID 3403145) has the molecular formula C10H6F3N5O4S and a molecular weight of 349.25 g/mol. Its IUPAC name is 3-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanyl-4-methyl-1,2,4-triazole.
| Compound Name | 3-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanyl-4-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 3403145 |
| Molecular Formula | C10H6F3N5O4S |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 3-[2,6-dinitro-4-(trifluoromethyl)phenyl]sulfanyl-4-methyl-1,2,4-triazole |
| SMILES | Cn1cnnc1Sc1c([N+](=O)[O-])cc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H6F3N5O4S/c1-16-4-14-15-9(16)23-8-6(17(19)20)2-5(10(11,12)13)3-7(8)18(21)22/h2-4H,1H3 |
| InChIKey | OIGQURHCOXRTPV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 116.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|