C13H7F3N2O4S — CID 3403214
1,3-dinitro-2-phenylsulfanyl-5-(trifluoromethyl)benzene (PubChem CID 3403214) has the molecular formula C13H7F3N2O4S and a molecular weight of 344.27 g/mol. Its IUPAC name is 1,3-dinitro-2-phenylsulfanyl-5-(trifluoromethyl)benzene.
| Compound Name | 1,3-dinitro-2-phenylsulfanyl-5-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 3403214 |
| Molecular Formula | C13H7F3N2O4S |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 344.01 |
| IUPAC Name | 1,3-dinitro-2-phenylsulfanyl-5-(trifluoromethyl)benzene |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1Sc1ccccc1 |
| InChI | InChI=1S/C13H7F3N2O4S/c14-13(15,16)8-6-10(17(19)20)12(11(7-8)18(21)22)23-9-4-2-1-3-5-9/h1-7H |
| InChIKey | HAAOFCJUNSSMLY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|