C19H19F3N2O4S — CID 34033203
N-[4-(difluoromethoxy)phenyl]-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 34033203) has the molecular formula C19H19F3N2O4S and a molecular weight of 428.43 g/mol. Its IUPAC name is N-[4-(difluoromethoxy)phenyl]-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[4-(difluoromethoxy)phenyl]-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 34033203 |
| Molecular Formula | C19H19F3N2O4S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | N-[4-(difluoromethoxy)phenyl]-1-(4-fluorophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)F)cc1)C1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H19F3N2O4S/c20-14-1-7-17(8-2-14)29(26,27)24-11-9-13(10-12-24)18(25)23-15-3-5-16(6-4-15)28-19(21)22/h1-8,13,19H,9-12H2,(H,23,25) |
| InChIKey | TWYAPVQNPHMERZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |