About N-(morpholine-4-carbothioyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide
N-(morpholine-4-carbothioyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide (PubChem CID 3403355) has the molecular formula C17H26N2O2S
and a molecular weight of 322.47 g/mol. Its IUPAC name is N-(morpholine-4-carbothioyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide.
Molecular Properties
| Compound Name | N-(morpholine-4-carbothioyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide |
| PubChem CID | 3403355 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | N-(morpholine-4-carbothioyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide |
| SMILES | O=C(NC(=S)N1CCOCC1)C12CCC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H26N2O2S/c20-15(18-16(22)19-3-5-21-6-4-19)17-2-1-12-7-13(10-17)9-14(8-12)11-17/h12-14H,1-11H2,(H,18,20,22) |
| InChIKey | UMSXWPSYLFTPBQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-(morpholine-4-carbothioyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(morpholine-4-carbothioyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide?
The IUPAC name of N-(morpholine-4-carbothioyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide (CID 3403355) is N-(morpholine-4-carbothioyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide.
What is the SMILES notation for N-(morpholine-4-carbothioyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide?
The canonical SMILES for N-(morpholine-4-carbothioyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide is O=C(NC(=S)N1CCOCC1)C12CCC3CC(CC(C3)C1)C2.
What is the InChIKey of N-(morpholine-4-carbothioyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide?
The InChIKey is UMSXWPSYLFTPBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H26N2O2S/c20-15(18-16(22)19-3-5-21-6-4-19)17-2-1-12-7-13(10-17)9-14(8-12)11-17/h12-14H,1-11H2,(H,18,20,22).
What are the key properties of N-(morpholine-4-carbothioyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide?
N-(morpholine-4-carbothioyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide has a molecular weight of 322.47 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(morpholine-4-carbothioyl)tricyclo[4.3.1.13,8]undecane-3-carboxamide is sourced from PubChem (CID 3403355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).