C25H30O3 — CID 3404224
2-[(2,4-dipropoxyphenyl)methylidene]-5,7-dimethyl-3,4-dihydronaphthalen-1-one (PubChem CID 3404224) has the molecular formula C25H30O3 and a molecular weight of 378.51 g/mol. Its IUPAC name is 2-[(2,4-dipropoxyphenyl)methylidene]-5,7-dimethyl-3,4-dihydronaphthalen-1-one.
| Compound Name | 2-[(2,4-dipropoxyphenyl)methylidene]-5,7-dimethyl-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 3404224 |
| Molecular Formula | C25H30O3 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 2-[(2,4-dipropoxyphenyl)methylidene]-5,7-dimethyl-3,4-dihydronaphthalen-1-one |
| SMILES | CCCOc1ccc(C=C2CCc3c(C)cc(C)cc3C2=O)c(OCCC)c1 |
| InChI | InChI=1S/C25H30O3/c1-5-11-27-21-9-7-19(24(16-21)28-12-6-2)15-20-8-10-22-18(4)13-17(3)14-23(22)25(20)26/h7,9,13-16H,5-6,8,10-12H2,1-4H3 |
| InChIKey | INRBQPHRGZHUNP-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|