C14H10F3N3S — CID 3404374
2-phenyl-2-(trifluoromethyl)-3H-pyrido[1,2-a][1,3,5]triazine-4-thione (PubChem CID 3404374) has the molecular formula C14H10F3N3S and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-phenyl-2-(trifluoromethyl)-3H-pyrido[1,2-a][1,3,5]triazine-4-thione.
| Compound Name | 2-phenyl-2-(trifluoromethyl)-3H-pyrido[1,2-a][1,3,5]triazine-4-thione |
|---|---|
| PubChem CID | 3404374 |
| Molecular Formula | C14H10F3N3S |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | 2-phenyl-2-(trifluoromethyl)-3H-pyrido[1,2-a][1,3,5]triazine-4-thione |
| SMILES | FC(F)(F)C1(c2ccccc2)N=C2C=CC=CN2C(=S)N1 |
| InChI | InChI=1S/C14H10F3N3S/c15-14(16,17)13(10-6-2-1-3-7-10)18-11-8-4-5-9-20(11)12(21)19-13/h1-9H,(H,19,21) |
| InChIKey | ZFZSLZWIGVGMHY-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|