C12H15N7S — CID 34043746
5-methyl-N-[2-(1-methylimidazol-2-yl)sulfanylethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 34043746) has the molecular formula C12H15N7S and a molecular weight of 289.37 g/mol. Its IUPAC name is 5-methyl-N-[2-(1-methylimidazol-2-yl)sulfanylethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-methyl-N-[2-(1-methylimidazol-2-yl)sulfanylethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 34043746 |
| Molecular Formula | C12H15N7S |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 5-methyl-N-[2-(1-methylimidazol-2-yl)sulfanylethyl]-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1cc(NCCSc2nccn2C)n2ncnc2n1 |
| InChI | InChI=1S/C12H15N7S/c1-9-7-10(19-11(17-9)15-8-16-19)13-4-6-20-12-14-3-5-18(12)2/h3,5,7-8,13H,4,6H2,1-2H3 |
| InChIKey | IZFXEDJVJQWMOX-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|