4-(2,5-dioxopyrrol-1-yl)butanoic acid

C8H9NO4 — CID 3404904

IUPAC4-(2,5-dioxopyrrol-1-yl)butanoic acid
SMILESO=C(O)CCCN1C(=O)C=CC1=O
InChIInChI=1S/C8H9NO4/c10-6-3-4-7(11)9(6)5-1-2-8(12)13/h3-4H,1-2,5H2,(H,12,13)
InChIKeyNCPQROHLJFARLL-UHFFFAOYSA-N
MW183.16 g/mol
LogP-0.22
Rot. Bonds4

About 4-(2,5-dioxopyrrol-1-yl)butanoic acid

4-(2,5-dioxopyrrol-1-yl)butanoic acid (PubChem CID 3404904) has the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. Its IUPAC name is 4-(2,5-dioxopyrrol-1-yl)butanoic acid.

Molecular Properties

Compound Name4-(2,5-dioxopyrrol-1-yl)butanoic acid
PubChem CID3404904
Molecular FormulaC8H9NO4
Molecular Weight183.16 g/mol
Exact Mass183.05
IUPAC Name4-(2,5-dioxopyrrol-1-yl)butanoic acid
SMILESO=C(O)CCCN1C(=O)C=CC1=O
InChIInChI=1S/C8H9NO4/c10-6-3-4-7(11)9(6)5-1-2-8(12)13/h3-4H,1-2,5H2,(H,12,13)
InChIKeyNCPQROHLJFARLL-UHFFFAOYSA-N
XLogP-0.22
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.16
LogP ≤ 5-0.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 4-(2,5-dioxopyrrol-1-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,5-dioxopyrrol-1-yl)butanoic acid?
The IUPAC name of 4-(2,5-dioxopyrrol-1-yl)butanoic acid (CID 3404904) is 4-(2,5-dioxopyrrol-1-yl)butanoic acid.
What is the SMILES notation for 4-(2,5-dioxopyrrol-1-yl)butanoic acid?
The canonical SMILES for 4-(2,5-dioxopyrrol-1-yl)butanoic acid is O=C(O)CCCN1C(=O)C=CC1=O.
What is the InChIKey of 4-(2,5-dioxopyrrol-1-yl)butanoic acid?
The InChIKey is NCPQROHLJFARLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO4/c10-6-3-4-7(11)9(6)5-1-2-8(12)13/h3-4H,1-2,5H2,(H,12,13).
What are the key properties of 4-(2,5-dioxopyrrol-1-yl)butanoic acid?
4-(2,5-dioxopyrrol-1-yl)butanoic acid has a molecular weight of 183.16 g/mol, XLogP of -0.22, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,5-dioxopyrrol-1-yl)butanoic acid is sourced from PubChem (CID 3404904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).