C24H24N2O6S — CID 34059714
methyl 3-[[5-[(2-methoxyphenyl)-methylsulfamoyl]-2-methylbenzoyl]amino]benzoate (PubChem CID 34059714) has the molecular formula C24H24N2O6S and a molecular weight of 468.53 g/mol. Its IUPAC name is methyl 3-[[5-[(2-methoxyphenyl)-methylsulfamoyl]-2-methylbenzoyl]amino]benzoate.
| Compound Name | methyl 3-[[5-[(2-methoxyphenyl)-methylsulfamoyl]-2-methylbenzoyl]amino]benzoate |
|---|---|
| PubChem CID | 34059714 |
| Molecular Formula | C24H24N2O6S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | methyl 3-[[5-[(2-methoxyphenyl)-methylsulfamoyl]-2-methylbenzoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2cc(S(=O)(=O)N(C)c3ccccc3OC)ccc2C)c1 |
| InChI | InChI=1S/C24H24N2O6S/c1-16-12-13-19(33(29,30)26(2)21-10-5-6-11-22(21)31-3)15-20(16)23(27)25-18-9-7-8-17(14-18)24(28)32-4/h5-15H,1-4H3,(H,25,27) |
| InChIKey | RXWPXDWTFSDYFS-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |