C25H24ClN3O4S — CID 34061557
2-[benzyl-(3-chlorophenyl)sulfonylamino]-N-[3-(2-oxopyrrolidin-1-yl)phenyl]acetamide (PubChem CID 34061557) has the molecular formula C25H24ClN3O4S and a molecular weight of 498.00 g/mol. Its IUPAC name is 2-[benzyl-(3-chlorophenyl)sulfonylamino]-N-[3-(2-oxopyrrolidin-1-yl)phenyl]acetamide.
| Compound Name | 2-[benzyl-(3-chlorophenyl)sulfonylamino]-N-[3-(2-oxopyrrolidin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 34061557 |
| Molecular Formula | C25H24ClN3O4S |
| Molecular Weight | 498.00 g/mol |
| Exact Mass | 497.12 |
| IUPAC Name | 2-[benzyl-(3-chlorophenyl)sulfonylamino]-N-[3-(2-oxopyrrolidin-1-yl)phenyl]acetamide |
| SMILES | O=C(CN(Cc1ccccc1)S(=O)(=O)c1cccc(Cl)c1)Nc1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C25H24ClN3O4S/c26-20-9-4-12-23(15-20)34(32,33)28(17-19-7-2-1-3-8-19)18-24(30)27-21-10-5-11-22(16-21)29-14-6-13-25(29)31/h1-5,7-12,15-16H,6,13-14,17-18H2,(H,27,30) |
| InChIKey | WLGHTXIHCCPGGV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.00 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |