C16H14FN3O3 — CID 34062304
(7aS)-2-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 34062304) has the molecular formula C16H14FN3O3 and a molecular weight of 315.30 g/mol. Its IUPAC name is (7aS)-2-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | (7aS)-2-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 34062304 |
| Molecular Formula | C16H14FN3O3 |
| Molecular Weight | 315.30 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | (7aS)-2-[[2-(3-fluorophenyl)-1,3-oxazol-4-yl]methyl]-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | O=C1[C@@H]2CCCN2C(=O)N1Cc1coc(-c2cccc(F)c2)n1 |
| InChI | InChI=1S/C16H14FN3O3/c17-11-4-1-3-10(7-11)14-18-12(9-23-14)8-20-15(21)13-5-2-6-19(13)16(20)22/h1,3-4,7,9,13H,2,5-6,8H2/t13-/m0/s1 |
| InChIKey | IREYXXAUROCPHV-ZDUSSCGKSA-N |
| XLogP | 2.41 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|